C20H16FN5O3S — CID 171357428
N-[4-fluoro-2-(2H-tetrazol-5-yl)phenyl]-4-(4-methoxyphenyl)benzenesulfonamide (PubChem CID 171357428) has the molecular formula C20H16FN5O3S and a molecular weight of 425.45 g/mol. Its IUPAC name is N-[4-fluoro-2-(2H-tetrazol-5-yl)phenyl]-4-(4-methoxyphenyl)benzenesulfonamide.
| Compound Name | N-[4-fluoro-2-(2H-tetrazol-5-yl)phenyl]-4-(4-methoxyphenyl)benzenesulfonamide |
|---|---|
| PubChem CID | 171357428 |
| Molecular Formula | C20H16FN5O3S |
| Molecular Weight | 425.45 g/mol |
| Exact Mass | 425.10 |
| IUPAC Name | N-[4-fluoro-2-(2H-tetrazol-5-yl)phenyl]-4-(4-methoxyphenyl)benzenesulfonamide |
| SMILES | COc1ccc(-c2ccc(S(=O)(=O)Nc3ccc(F)cc3-c3nn[nH]n3)cc2)cc1 |
| InChI | InChI=1S/C20H16FN5O3S/c1-29-16-7-2-13(3-8-16)14-4-9-17(10-5-14)30(27,28)24-19-11-6-15(21)12-18(19)20-22-25-26-23-20/h2-12,24H,1H3,(H,22,23,25,26) |
| InChIKey | FEMGIKMSAJLVRJ-UHFFFAOYSA-N |
| XLogP | 3.48 |
| TPSA | 109.86 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.45 |
| LogP ≤ 5 | 3.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |