C35H44N6O6S — CID 91607262
[4-(2-azidoethoxy)-3-methoxyphenyl]methyl thiocyanate;[2-[(3-methoxy-4-methylphenyl)methylcarbamoylamino]-3-phenylpropyl] 2,2-dimethylpropanoate (PubChem CID 91607262) has the molecular formula C35H44N6O6S and a molecular weight of 676.84 g/mol. Its IUPAC name is [4-(2-azidoethoxy)-3-methoxyphenyl]methyl thiocyanate;[2-[(3-methoxy-4-methylphenyl)methylcarbamoylamino]-3-phenylpropyl] 2,2-dimethylpropanoate.
| Compound Name | [4-(2-azidoethoxy)-3-methoxyphenyl]methyl thiocyanate;[2-[(3-methoxy-4-methylphenyl)methylcarbamoylamino]-3-phenylpropyl] 2,2-dimethylpropanoate |
|---|---|
| PubChem CID | 91607262 |
| Molecular Formula | C35H44N6O6S |
| Molecular Weight | 676.84 g/mol |
| Exact Mass | 676.30 |
| IUPAC Name | [4-(2-azidoethoxy)-3-methoxyphenyl]methyl thiocyanate;[2-[(3-methoxy-4-methylphenyl)methylcarbamoylamino]-3-phenylpropyl] 2,2-dimethylpropanoate |
| SMILES | COc1cc(CNC(=O)NC(COC(=O)C(C)(C)C)Cc2ccccc2)ccc1C.COc1cc(CSC#N)ccc1OCCN=[N+]=[N-] |
| InChI | InChI=1S/C24H32N2O4.C11H12N4O2S/c1-17-11-12-19(14-21(17)29-5)15-25-23(28)26-20(13-18-9-7-6-8-10-18)16-30-22(27)24(2,3)4;1-16-11-6-9(7-18-8-12)2-3-10(11)17-5-4-14-15-13/h6-12,14,20H,13,15-16H2,1-5H3,(H2,25,26,28);2-3,6H,4-5,7H2,1H3 |
| InChIKey | ZHHLVWJDJVWFQD-UHFFFAOYSA-N |
| XLogP | 7.10 |
| TPSA | 167.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 676.84 |
| LogP ≤ 5 | 7.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'cyanate_/aminonitrile_/thiocyanate', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'} |
|---|