C25H34N2O4S — CID 10115388
[3-(3,4-dimethylphenyl)-2-[(4-hydroxy-3-methoxyphenyl)methylcarbamothioylamino]propyl] 2,2-dimethylpropanoate (PubChem CID 10115388) has the molecular formula C25H34N2O4S and a molecular weight of 458.62 g/mol. Its IUPAC name is [3-(3,4-dimethylphenyl)-2-[(4-hydroxy-3-methoxyphenyl)methylcarbamothioylamino]propyl] 2,2-dimethylpropanoate.
| Compound Name | [3-(3,4-dimethylphenyl)-2-[(4-hydroxy-3-methoxyphenyl)methylcarbamothioylamino]propyl] 2,2-dimethylpropanoate |
|---|---|
| PubChem CID | 10115388 |
| Molecular Formula | C25H34N2O4S |
| Molecular Weight | 458.62 g/mol |
| Exact Mass | 458.22 |
| IUPAC Name | [3-(3,4-dimethylphenyl)-2-[(4-hydroxy-3-methoxyphenyl)methylcarbamothioylamino]propyl] 2,2-dimethylpropanoate |
| SMILES | COc1cc(CNC(=S)NC(COC(=O)C(C)(C)C)Cc2ccc(C)c(C)c2)ccc1O |
| InChI | InChI=1S/C25H34N2O4S/c1-16-7-8-18(11-17(16)2)12-20(15-31-23(29)25(3,4)5)27-24(32)26-14-19-9-10-21(28)22(13-19)30-6/h7-11,13,20,28H,12,14-15H2,1-6H3,(H2,26,27,32) |
| InChIKey | JWMDNAJBCHAJLJ-UHFFFAOYSA-N |
| XLogP | 4.18 |
| TPSA | 79.82 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 458.62 |
| LogP ≤ 5 | 4.18 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|