C27H38N2O5S — CID 22507392
[3-(3,4-dimethylphenyl)-1-[[3-methoxy-4-(methoxymethoxy)phenyl]methylcarbamothioylamino]propyl] 2,2-dimethylpropanoate (PubChem CID 22507392) has the molecular formula C27H38N2O5S and a molecular weight of 502.68 g/mol. Its IUPAC name is [3-(3,4-dimethylphenyl)-1-[[3-methoxy-4-(methoxymethoxy)phenyl]methylcarbamothioylamino]propyl] 2,2-dimethylpropanoate.
| Compound Name | [3-(3,4-dimethylphenyl)-1-[[3-methoxy-4-(methoxymethoxy)phenyl]methylcarbamothioylamino]propyl] 2,2-dimethylpropanoate |
|---|---|
| PubChem CID | 22507392 |
| Molecular Formula | C27H38N2O5S |
| Molecular Weight | 502.68 g/mol |
| Exact Mass | 502.25 |
| IUPAC Name | [3-(3,4-dimethylphenyl)-1-[[3-methoxy-4-(methoxymethoxy)phenyl]methylcarbamothioylamino]propyl] 2,2-dimethylpropanoate |
| SMILES | COCOc1ccc(CNC(=S)NC(CCc2ccc(C)c(C)c2)OC(=O)C(C)(C)C)cc1OC |
| InChI | InChI=1S/C27H38N2O5S/c1-18-8-9-20(14-19(18)2)11-13-24(34-25(30)27(3,4)5)29-26(35)28-16-21-10-12-22(33-17-31-6)23(15-21)32-7/h8-10,12,14-15,24H,11,13,16-17H2,1-7H3,(H2,28,29,35) |
| InChIKey | HAIWASIWTKAVHL-UHFFFAOYSA-N |
| XLogP | 4.81 |
| TPSA | 78.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 502.68 |
| LogP ≤ 5 | 4.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|