C25H34N2O5 — CID 22507327
[1-[carbamoyl-[(4-hydroxy-3-methoxyphenyl)methyl]amino]-3-(3,4-dimethylphenyl)propyl] 2,2-dimethylpropanoate (PubChem CID 22507327) has the molecular formula C25H34N2O5 and a molecular weight of 442.56 g/mol. Its IUPAC name is [1-[carbamoyl-[(4-hydroxy-3-methoxyphenyl)methyl]amino]-3-(3,4-dimethylphenyl)propyl] 2,2-dimethylpropanoate.
| Compound Name | [1-[carbamoyl-[(4-hydroxy-3-methoxyphenyl)methyl]amino]-3-(3,4-dimethylphenyl)propyl] 2,2-dimethylpropanoate |
|---|---|
| PubChem CID | 22507327 |
| Molecular Formula | C25H34N2O5 |
| Molecular Weight | 442.56 g/mol |
| Exact Mass | 442.25 |
| IUPAC Name | [1-[carbamoyl-[(4-hydroxy-3-methoxyphenyl)methyl]amino]-3-(3,4-dimethylphenyl)propyl] 2,2-dimethylpropanoate |
| SMILES | COc1cc(CN(C(N)=O)C(CCc2ccc(C)c(C)c2)OC(=O)C(C)(C)C)ccc1O |
| InChI | InChI=1S/C25H34N2O5/c1-16-7-8-18(13-17(16)2)10-12-22(32-23(29)25(3,4)5)27(24(26)30)15-19-9-11-20(28)21(14-19)31-6/h7-9,11,13-14,22,28H,10,12,15H2,1-6H3,(H2,26,30) |
| InChIKey | JTFKSAGAIWYQDV-UHFFFAOYSA-N |
| XLogP | 4.45 |
| TPSA | 102.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.56 |
| LogP ≤ 5 | 4.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|