C28H39N5O4S — CID 142660326
[2-[[4-(2-azidoethoxy)-3-methoxyphenyl]methyl-carbamothioylamino]-4-(3,4-dimethylphenyl)butyl] 2,2-dimethylpropanoate (PubChem CID 142660326) has the molecular formula C28H39N5O4S and a molecular weight of 541.72 g/mol. Its IUPAC name is [2-[[4-(2-azidoethoxy)-3-methoxyphenyl]methyl-carbamothioylamino]-4-(3,4-dimethylphenyl)butyl] 2,2-dimethylpropanoate.
| Compound Name | [2-[[4-(2-azidoethoxy)-3-methoxyphenyl]methyl-carbamothioylamino]-4-(3,4-dimethylphenyl)butyl] 2,2-dimethylpropanoate |
|---|---|
| PubChem CID | 142660326 |
| Molecular Formula | C28H39N5O4S |
| Molecular Weight | 541.72 g/mol |
| Exact Mass | 541.27 |
| IUPAC Name | [2-[[4-(2-azidoethoxy)-3-methoxyphenyl]methyl-carbamothioylamino]-4-(3,4-dimethylphenyl)butyl] 2,2-dimethylpropanoate |
| SMILES | COc1cc(CN(C(N)=S)C(CCc2ccc(C)c(C)c2)COC(=O)C(C)(C)C)ccc1OCCN=[N+]=[N-] |
| InChI | InChI=1S/C28H39N5O4S/c1-19-7-8-21(15-20(19)2)9-11-23(18-37-26(34)28(3,4)5)33(27(29)38)17-22-10-12-24(25(16-22)35-6)36-14-13-31-32-30/h7-8,10,12,15-16,23H,9,11,13-14,17-18H2,1-6H3,(H2,29,38) |
| InChIKey | QGGDLNUCOSOSGS-UHFFFAOYSA-N |
| XLogP | 5.64 |
| TPSA | 122.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 541.72 |
| LogP ≤ 5 | 5.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|