C22H24F3N5O2S — CID 58119090
2-amino-4-[[(3S)-2,8-dioxo-1-[3-(trifluoromethyl)phenyl]nonan-3-yl]amino]-6-methylsulfanylpyrimidine-5-carbonitrile (PubChem CID 58119090) has the molecular formula C22H24F3N5O2S and a molecular weight of 479.53 g/mol. Its IUPAC name is 2-amino-4-[[(3S)-2,8-dioxo-1-[3-(trifluoromethyl)phenyl]nonan-3-yl]amino]-6-methylsulfanylpyrimidine-5-carbonitrile.
| Compound Name | 2-amino-4-[[(3S)-2,8-dioxo-1-[3-(trifluoromethyl)phenyl]nonan-3-yl]amino]-6-methylsulfanylpyrimidine-5-carbonitrile |
|---|---|
| PubChem CID | 58119090 |
| Molecular Formula | C22H24F3N5O2S |
| Molecular Weight | 479.53 g/mol |
| Exact Mass | 479.16 |
| IUPAC Name | 2-amino-4-[[(3S)-2,8-dioxo-1-[3-(trifluoromethyl)phenyl]nonan-3-yl]amino]-6-methylsulfanylpyrimidine-5-carbonitrile |
| SMILES | CSc1nc(N)nc(N[C@@H](CCCCC(C)=O)C(=O)Cc2cccc(C(F)(F)F)c2)c1C#N |
| InChI | InChI=1S/C22H24F3N5O2S/c1-13(31)6-3-4-9-17(28-19-16(12-26)20(33-2)30-21(27)29-19)18(32)11-14-7-5-8-15(10-14)22(23,24)25/h5,7-8,10,17H,3-4,6,9,11H2,1-2H3,(H3,27,28,29,30)/t17-/m0/s1 |
| InChIKey | PUZCVDWUKWJSKN-KRWDZBQOSA-N |
| XLogP | 4.41 |
| TPSA | 121.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 479.53 |
| LogP ≤ 5 | 4.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|