C20H22F3N7O4 — CID 68650096
[(4S)-4-[(2-amino-5-cyano-6-ethoxypyrimidin-4-yl)amino]-5-oxo-5-[3-(trifluoromethyl)anilino]pentyl] carbamate (PubChem CID 68650096) has the molecular formula C20H22F3N7O4 and a molecular weight of 481.44 g/mol. Its IUPAC name is [(4S)-4-[(2-amino-5-cyano-6-ethoxypyrimidin-4-yl)amino]-5-oxo-5-[3-(trifluoromethyl)anilino]pentyl] carbamate.
| Compound Name | [(4S)-4-[(2-amino-5-cyano-6-ethoxypyrimidin-4-yl)amino]-5-oxo-5-[3-(trifluoromethyl)anilino]pentyl] carbamate |
|---|---|
| PubChem CID | 68650096 |
| Molecular Formula | C20H22F3N7O4 |
| Molecular Weight | 481.44 g/mol |
| Exact Mass | 481.17 |
| IUPAC Name | [(4S)-4-[(2-amino-5-cyano-6-ethoxypyrimidin-4-yl)amino]-5-oxo-5-[3-(trifluoromethyl)anilino]pentyl] carbamate |
| SMILES | CCOc1nc(N)nc(N[C@@H](CCCOC(N)=O)C(=O)Nc2cccc(C(F)(F)F)c2)c1C#N |
| InChI | InChI=1S/C20H22F3N7O4/c1-2-33-17-13(10-24)15(29-18(25)30-17)28-14(7-4-8-34-19(26)32)16(31)27-12-6-3-5-11(9-12)20(21,22)23/h3,5-6,9,14H,2,4,7-8H2,1H3,(H2,26,32)(H,27,31)(H3,25,28,29,30)/t14-/m0/s1 |
| InChIKey | CSWQRAUHHUNQDT-AWEZNQCLSA-N |
| XLogP | 2.64 |
| TPSA | 178.27 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 481.44 |
| LogP ≤ 5 | 2.64 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|