C15H16FN5O2 — CID 89021618
2-[(2-amino-5-formyl-6-methylpyrimidin-4-yl)amino]-N-[3-(fluoromethyl)phenyl]acetamide (PubChem CID 89021618) has the molecular formula C15H16FN5O2 and a molecular weight of 317.32 g/mol. Its IUPAC name is 2-[(2-amino-5-formyl-6-methylpyrimidin-4-yl)amino]-N-[3-(fluoromethyl)phenyl]acetamide.
| Compound Name | 2-[(2-amino-5-formyl-6-methylpyrimidin-4-yl)amino]-N-[3-(fluoromethyl)phenyl]acetamide |
|---|---|
| PubChem CID | 89021618 |
| Molecular Formula | C15H16FN5O2 |
| Molecular Weight | 317.32 g/mol |
| Exact Mass | 317.13 |
| IUPAC Name | 2-[(2-amino-5-formyl-6-methylpyrimidin-4-yl)amino]-N-[3-(fluoromethyl)phenyl]acetamide |
| SMILES | Cc1nc(N)nc(NCC(=O)Nc2cccc(CF)c2)c1C=O |
| InChI | InChI=1S/C15H16FN5O2/c1-9-12(8-22)14(21-15(17)19-9)18-7-13(23)20-11-4-2-3-10(5-11)6-16/h2-5,8H,6-7H2,1H3,(H,20,23)(H3,17,18,19,21) |
| InChIKey | RNQGHWRNRNUMRS-UHFFFAOYSA-N |
| XLogP | 1.70 |
| TPSA | 110.00 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.32 |
| LogP ≤ 5 | 1.70 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|