C13H20N2O2 — CID 142634333
(2S)-6-amino-2-(2-deuterio-3-methylanilino)hexanoic acid (PubChem CID 142634333) has the molecular formula C13H20N2O2 and a molecular weight of 237.32 g/mol. Its IUPAC name is (2S)-6-amino-2-(2-deuterio-3-methylanilino)hexanoic acid.
| Compound Name | (2S)-6-amino-2-(2-deuterio-3-methylanilino)hexanoic acid |
|---|---|
| PubChem CID | 142634333 |
| Molecular Formula | C13H20N2O2 |
| Molecular Weight | 237.32 g/mol |
| Exact Mass | 237.16 |
| IUPAC Name | (2S)-6-amino-2-(2-deuterio-3-methylanilino)hexanoic acid |
| SMILES | [2H]c1c(C)cccc1N[C@@H](CCCCN)C(=O)O |
| InChI | InChI=1S/C13H20N2O2/c1-10-5-4-6-11(9-10)15-12(13(16)17)7-2-3-8-14/h4-6,9,12,15H,2-3,7-8,14H2,1H3,(H,16,17)/t12-/m0/s1/i9D |
| InChIKey | BUKLPWHGJDDBMF-VVXDVERMSA-N |
| XLogP | 1.99 |
| TPSA | 75.35 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 237.32 |
| LogP ≤ 5 | 1.99 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|