C11H11F4NO2 — CID 67368661
(2S)-3-fluoro-2-[3-(trifluoromethyl)anilino]butanoic acid (PubChem CID 67368661) has the molecular formula C11H11F4NO2 and a molecular weight of 265.21 g/mol. Its IUPAC name is (2S)-3-fluoro-2-[3-(trifluoromethyl)anilino]butanoic acid.
| Compound Name | (2S)-3-fluoro-2-[3-(trifluoromethyl)anilino]butanoic acid |
|---|---|
| PubChem CID | 67368661 |
| Molecular Formula | C11H11F4NO2 |
| Molecular Weight | 265.21 g/mol |
| Exact Mass | 265.07 |
| IUPAC Name | (2S)-3-fluoro-2-[3-(trifluoromethyl)anilino]butanoic acid |
| SMILES | CC(F)[C@@H](Nc1cccc(C(F)(F)F)c1)C(=O)O |
| InChI | InChI=1S/C11H11F4NO2/c1-6(12)9(10(17)18)16-8-4-2-3-7(5-8)11(13,14)15/h2-6,9,16H,1H3,(H,17,18)/t6?,9-/m1/s1 |
| InChIKey | UQMFSWFZNAVAEP-IOJJLOCKSA-N |
| XLogP | 2.93 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 265.21 |
| LogP ≤ 5 | 2.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |