C14H18F2O3 — CID 116754234
(2,3-difluorophenyl)-(4-ethoxyoxan-4-yl)methanol (PubChem CID 116754234) has the molecular formula C14H18F2O3 and a molecular weight of 272.29 g/mol. Its IUPAC name is (2,3-difluorophenyl)-(4-ethoxyoxan-4-yl)methanol.
| Compound Name | (2,3-difluorophenyl)-(4-ethoxyoxan-4-yl)methanol |
|---|---|
| PubChem CID | 116754234 |
| Molecular Formula | C14H18F2O3 |
| Molecular Weight | 272.29 g/mol |
| Exact Mass | 272.12 |
| IUPAC Name | (2,3-difluorophenyl)-(4-ethoxyoxan-4-yl)methanol |
| SMILES | CCOC1(C(O)c2cccc(F)c2F)CCOCC1 |
| InChI | InChI=1S/C14H18F2O3/c1-2-19-14(6-8-18-9-7-14)13(17)10-4-3-5-11(15)12(10)16/h3-5,13,17H,2,6-9H2,1H3 |
| InChIKey | UEILGVZUOCIKGK-UHFFFAOYSA-N |
| XLogP | 2.58 |
| TPSA | 38.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.29 |
| LogP ≤ 5 | 2.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |