C15H20F2O2 — CID 116753674
(2,3-difluorophenyl)-(1-ethoxycyclohexyl)methanol (PubChem CID 116753674) has the molecular formula C15H20F2O2 and a molecular weight of 270.32 g/mol. Its IUPAC name is (2,3-difluorophenyl)-(1-ethoxycyclohexyl)methanol.
| Compound Name | (2,3-difluorophenyl)-(1-ethoxycyclohexyl)methanol |
|---|---|
| PubChem CID | 116753674 |
| Molecular Formula | C15H20F2O2 |
| Molecular Weight | 270.32 g/mol |
| Exact Mass | 270.14 |
| IUPAC Name | (2,3-difluorophenyl)-(1-ethoxycyclohexyl)methanol |
| SMILES | CCOC1(C(O)c2cccc(F)c2F)CCCCC1 |
| InChI | InChI=1S/C15H20F2O2/c1-2-19-15(9-4-3-5-10-15)14(18)11-7-6-8-12(16)13(11)17/h6-8,14,18H,2-5,9-10H2,1H3 |
| InChIKey | WHPAYYBXMABQMZ-UHFFFAOYSA-N |
| XLogP | 3.74 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.32 |
| LogP ≤ 5 | 3.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |