C18H28O2 — CID 116755399
(1-ethoxy-4,4-dimethylcyclohexyl)-(2-methylphenyl)methanol (PubChem CID 116755399) has the molecular formula C18H28O2 and a molecular weight of 276.42 g/mol. Its IUPAC name is (1-ethoxy-4,4-dimethylcyclohexyl)-(2-methylphenyl)methanol.
| Compound Name | (1-ethoxy-4,4-dimethylcyclohexyl)-(2-methylphenyl)methanol |
|---|---|
| PubChem CID | 116755399 |
| Molecular Formula | C18H28O2 |
| Molecular Weight | 276.42 g/mol |
| Exact Mass | 276.21 |
| IUPAC Name | (1-ethoxy-4,4-dimethylcyclohexyl)-(2-methylphenyl)methanol |
| SMILES | CCOC1(C(O)c2ccccc2C)CCC(C)(C)CC1 |
| InChI | InChI=1S/C18H28O2/c1-5-20-18(12-10-17(3,4)11-13-18)16(19)15-9-7-6-8-14(15)2/h6-9,16,19H,5,10-13H2,1-4H3 |
| InChIKey | IYDDYWZIHJNPMG-UHFFFAOYSA-N |
| XLogP | 4.40 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.42 |
| LogP ≤ 5 | 4.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |