C14H18Cl2O3 — CID 116754164
(3,4-dichlorophenyl)-(4-ethoxyoxan-4-yl)methanol (PubChem CID 116754164) has the molecular formula C14H18Cl2O3 and a molecular weight of 305.20 g/mol. Its IUPAC name is (3,4-dichlorophenyl)-(4-ethoxyoxan-4-yl)methanol.
| Compound Name | (3,4-dichlorophenyl)-(4-ethoxyoxan-4-yl)methanol |
|---|---|
| PubChem CID | 116754164 |
| Molecular Formula | C14H18Cl2O3 |
| Molecular Weight | 305.20 g/mol |
| Exact Mass | 304.06 |
| IUPAC Name | (3,4-dichlorophenyl)-(4-ethoxyoxan-4-yl)methanol |
| SMILES | CCOC1(C(O)c2ccc(Cl)c(Cl)c2)CCOCC1 |
| InChI | InChI=1S/C14H18Cl2O3/c1-2-19-14(5-7-18-8-6-14)13(17)10-3-4-11(15)12(16)9-10/h3-4,9,13,17H,2,5-8H2,1H3 |
| InChIKey | PEFPEZBVGHNWTG-UHFFFAOYSA-N |
| XLogP | 3.61 |
| TPSA | 38.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.20 |
| LogP ≤ 5 | 3.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |