C14H23ClN2O3 — CID 114645850
(4-chloro-1-propan-2-ylpyrazol-5-yl)-(4-ethoxyoxan-4-yl)methanol (PubChem CID 114645850) has the molecular formula C14H23ClN2O3 and a molecular weight of 302.80 g/mol. Its IUPAC name is (4-chloro-1-propan-2-ylpyrazol-5-yl)-(4-ethoxyoxan-4-yl)methanol.
| Compound Name | (4-chloro-1-propan-2-ylpyrazol-5-yl)-(4-ethoxyoxan-4-yl)methanol |
|---|---|
| PubChem CID | 114645850 |
| Molecular Formula | C14H23ClN2O3 |
| Molecular Weight | 302.80 g/mol |
| Exact Mass | 302.14 |
| IUPAC Name | (4-chloro-1-propan-2-ylpyrazol-5-yl)-(4-ethoxyoxan-4-yl)methanol |
| SMILES | CCOC1(C(O)c2c(Cl)cnn2C(C)C)CCOCC1 |
| InChI | InChI=1S/C14H23ClN2O3/c1-4-20-14(5-7-19-8-6-14)13(18)12-11(15)9-16-17(12)10(2)3/h9-10,13,18H,4-8H2,1-3H3 |
| InChIKey | GSLBLJOHQGBJGR-UHFFFAOYSA-N |
| XLogP | 2.74 |
| TPSA | 56.51 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.80 |
| LogP ≤ 5 | 2.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |