C12H13F4N — CID 154991049
(R)-[3-fluoro-4-(trifluoromethyl)phenyl]-(1-methylcyclopropyl)methanamine (PubChem CID 154991049) has the molecular formula C12H13F4N and a molecular weight of 247.24 g/mol. Its IUPAC name is (R)-[3-fluoro-4-(trifluoromethyl)phenyl]-(1-methylcyclopropyl)methanamine.
| Compound Name | (R)-[3-fluoro-4-(trifluoromethyl)phenyl]-(1-methylcyclopropyl)methanamine |
|---|---|
| PubChem CID | 154991049 |
| Molecular Formula | C12H13F4N |
| Molecular Weight | 247.24 g/mol |
| Exact Mass | 247.10 |
| IUPAC Name | (R)-[3-fluoro-4-(trifluoromethyl)phenyl]-(1-methylcyclopropyl)methanamine |
| SMILES | CC1([C@@H](N)c2ccc(C(F)(F)F)c(F)c2)CC1 |
| InChI | InChI=1S/C12H13F4N/c1-11(4-5-11)10(17)7-2-3-8(9(13)6-7)12(14,15)16/h2-3,6,10H,4-5,17H2,1H3/t10-/m0/s1 |
| InChIKey | PLAAURGNEOUBTI-JTQLQIEISA-N |
| XLogP | 3.64 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 247.24 |
| LogP ≤ 5 | 3.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |