C15H18F4O — CID 107292057
[3-fluoro-4-(trifluoromethyl)phenyl]-(1-methylcyclohexyl)methanol (PubChem CID 107292057) has the molecular formula C15H18F4O and a molecular weight of 290.30 g/mol. Its IUPAC name is [3-fluoro-4-(trifluoromethyl)phenyl]-(1-methylcyclohexyl)methanol.
| Compound Name | [3-fluoro-4-(trifluoromethyl)phenyl]-(1-methylcyclohexyl)methanol |
|---|---|
| PubChem CID | 107292057 |
| Molecular Formula | C15H18F4O |
| Molecular Weight | 290.30 g/mol |
| Exact Mass | 290.13 |
| IUPAC Name | [3-fluoro-4-(trifluoromethyl)phenyl]-(1-methylcyclohexyl)methanol |
| SMILES | CC1(C(O)c2ccc(C(F)(F)F)c(F)c2)CCCCC1 |
| InChI | InChI=1S/C15H18F4O/c1-14(7-3-2-4-8-14)13(20)10-5-6-11(12(16)9-10)15(17,18)19/h5-6,9,13,20H,2-4,7-8H2,1H3 |
| InChIKey | HUTMEAMTKVADRJ-UHFFFAOYSA-N |
| XLogP | 4.85 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.30 |
| LogP ≤ 5 | 4.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |