C17H24O2 — CID 106828329
3,4-dihydro-2H-chromen-6-yl-(1-methylcyclohexyl)methanol (PubChem CID 106828329) has the molecular formula C17H24O2 and a molecular weight of 260.38 g/mol. Its IUPAC name is 3,4-dihydro-2H-chromen-6-yl-(1-methylcyclohexyl)methanol.
| Compound Name | 3,4-dihydro-2H-chromen-6-yl-(1-methylcyclohexyl)methanol |
|---|---|
| PubChem CID | 106828329 |
| Molecular Formula | C17H24O2 |
| Molecular Weight | 260.38 g/mol |
| Exact Mass | 260.18 |
| IUPAC Name | 3,4-dihydro-2H-chromen-6-yl-(1-methylcyclohexyl)methanol |
| SMILES | CC1(C(O)c2ccc3c(c2)CCCO3)CCCCC1 |
| InChI | InChI=1S/C17H24O2/c1-17(9-3-2-4-10-17)16(18)14-7-8-15-13(12-14)6-5-11-19-15/h7-8,12,16,18H,2-6,9-11H2,1H3 |
| InChIKey | HBHITXMCIFAAJO-UHFFFAOYSA-N |
| XLogP | 4.02 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 260.38 |
| LogP ≤ 5 | 4.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |