C10H15NO3 — CID 170817590
1-[3-(aminomethyl)phenyl]propane-1,2,3-triol (PubChem CID 170817590) has the molecular formula C10H15NO3 and a molecular weight of 197.23 g/mol. Its IUPAC name is 1-[3-(aminomethyl)phenyl]propane-1,2,3-triol.
| Compound Name | 1-[3-(aminomethyl)phenyl]propane-1,2,3-triol |
|---|---|
| PubChem CID | 170817590 |
| Molecular Formula | C10H15NO3 |
| Molecular Weight | 197.23 g/mol |
| Exact Mass | 197.11 |
| IUPAC Name | 1-[3-(aminomethyl)phenyl]propane-1,2,3-triol |
| SMILES | NCc1cccc(C(O)C(O)CO)c1 |
| InChI | InChI=1S/C10H15NO3/c11-5-7-2-1-3-8(4-7)10(14)9(13)6-12/h1-4,9-10,12-14H,5-6,11H2 |
| InChIKey | PJBXVOPEXURKOI-UHFFFAOYSA-N |
| XLogP | -0.47 |
| TPSA | 86.71 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 197.23 |
| LogP ≤ 5 | -0.47 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |