C16H25Cl2F3N2 — CID 171303945
1-[(1R)-1-(4-ethylphenyl)-4,4,4-trifluorobutyl]piperazine;dihydrochloride (PubChem CID 171303945) has the molecular formula C16H25Cl2F3N2 and a molecular weight of 373.29 g/mol. Its IUPAC name is 1-[(1R)-1-(4-ethylphenyl)-4,4,4-trifluorobutyl]piperazine;dihydrochloride.
| Compound Name | 1-[(1R)-1-(4-ethylphenyl)-4,4,4-trifluorobutyl]piperazine;dihydrochloride |
|---|---|
| PubChem CID | 171303945 |
| Molecular Formula | C16H25Cl2F3N2 |
| Molecular Weight | 373.29 g/mol |
| Exact Mass | 372.13 |
| IUPAC Name | 1-[(1R)-1-(4-ethylphenyl)-4,4,4-trifluorobutyl]piperazine;dihydrochloride |
| SMILES | CCc1ccc([C@@H](CCC(F)(F)F)N2CCNCC2)cc1.Cl.Cl |
| InChI | InChI=1S/C16H23F3N2.2ClH/c1-2-13-3-5-14(6-4-13)15(7-8-16(17,18)19)21-11-9-20-10-12-21;;/h3-6,15,20H,2,7-12H2,1H3;2*1H/t15-;;/m1../s1 |
| InChIKey | NUNLRYWSXGONCS-QCUBGVIVSA-N |
| XLogP | 4.38 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.29 |
| LogP ≤ 5 | 4.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |