C12H23Cl2N3 — CID 171287820
1-[(1R)-1-(1H-pyrrol-2-yl)butyl]piperazine;dihydrochloride (PubChem CID 171287820) has the molecular formula C12H23Cl2N3 and a molecular weight of 280.24 g/mol. Its IUPAC name is 1-[(1R)-1-(1H-pyrrol-2-yl)butyl]piperazine;dihydrochloride.
| Compound Name | 1-[(1R)-1-(1H-pyrrol-2-yl)butyl]piperazine;dihydrochloride |
|---|---|
| PubChem CID | 171287820 |
| Molecular Formula | C12H23Cl2N3 |
| Molecular Weight | 280.24 g/mol |
| Exact Mass | 279.13 |
| IUPAC Name | 1-[(1R)-1-(1H-pyrrol-2-yl)butyl]piperazine;dihydrochloride |
| SMILES | CCC[C@H](c1ccc[nH]1)N1CCNCC1.Cl.Cl |
| InChI | InChI=1S/C12H21N3.2ClH/c1-2-4-12(11-5-3-6-14-11)15-9-7-13-8-10-15;;/h3,5-6,12-14H,2,4,7-10H2,1H3;2*1H/t12-;;/m1../s1 |
| InChIKey | PSXUZAPKRJNOGN-CURYUGHLSA-N |
| XLogP | 2.60 |
| TPSA | 31.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.24 |
| LogP ≤ 5 | 2.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |