C14H24Cl2N2O2 — CID 171273865
5-[(1S)-1-piperazin-1-ylbutyl]benzene-1,3-diol;dihydrochloride (PubChem CID 171273865) has the molecular formula C14H24Cl2N2O2 and a molecular weight of 323.26 g/mol. Its IUPAC name is 5-[(1S)-1-piperazin-1-ylbutyl]benzene-1,3-diol;dihydrochloride.
| Compound Name | 5-[(1S)-1-piperazin-1-ylbutyl]benzene-1,3-diol;dihydrochloride |
|---|---|
| PubChem CID | 171273865 |
| Molecular Formula | C14H24Cl2N2O2 |
| Molecular Weight | 323.26 g/mol |
| Exact Mass | 322.12 |
| IUPAC Name | 5-[(1S)-1-piperazin-1-ylbutyl]benzene-1,3-diol;dihydrochloride |
| SMILES | CCC[C@@H](c1cc(O)cc(O)c1)N1CCNCC1.Cl.Cl |
| InChI | InChI=1S/C14H22N2O2.2ClH/c1-2-3-14(16-6-4-15-5-7-16)11-8-12(17)10-13(18)9-11;;/h8-10,14-15,17-18H,2-7H2,1H3;2*1H/t14-;;/m0../s1 |
| InChIKey | RPCFSRWOYMHRHU-UTLKBRERSA-N |
| XLogP | 2.69 |
| TPSA | 55.73 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.26 |
| LogP ≤ 5 | 2.69 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |