C18H26Cl2N2O — CID 171275163
6-[(1S)-1-piperazin-1-ylbutyl]naphthalen-2-ol;dihydrochloride (PubChem CID 171275163) has the molecular formula C18H26Cl2N2O and a molecular weight of 357.33 g/mol. Its IUPAC name is 6-[(1S)-1-piperazin-1-ylbutyl]naphthalen-2-ol;dihydrochloride.
| Compound Name | 6-[(1S)-1-piperazin-1-ylbutyl]naphthalen-2-ol;dihydrochloride |
|---|---|
| PubChem CID | 171275163 |
| Molecular Formula | C18H26Cl2N2O |
| Molecular Weight | 357.33 g/mol |
| Exact Mass | 356.14 |
| IUPAC Name | 6-[(1S)-1-piperazin-1-ylbutyl]naphthalen-2-ol;dihydrochloride |
| SMILES | CCC[C@@H](c1ccc2cc(O)ccc2c1)N1CCNCC1.Cl.Cl |
| InChI | InChI=1S/C18H24N2O.2ClH/c1-2-3-18(20-10-8-19-9-11-20)16-5-4-15-13-17(21)7-6-14(15)12-16;;/h4-7,12-13,18-19,21H,2-3,8-11H2,1H3;2*1H/t18-;;/m0../s1 |
| InChIKey | ZNBFMVUCQBCATH-NTEVMMBTSA-N |
| XLogP | 4.14 |
| TPSA | 35.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.33 |
| LogP ≤ 5 | 4.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |