C19H24N2O — CID 171287800
6-[(1R)-3-methyl-1-piperazin-1-ylbut-3-enyl]naphthalen-2-ol (PubChem CID 171287800) has the molecular formula C19H24N2O and a molecular weight of 296.41 g/mol. Its IUPAC name is 6-[(1R)-3-methyl-1-piperazin-1-ylbut-3-enyl]naphthalen-2-ol.
| Compound Name | 6-[(1R)-3-methyl-1-piperazin-1-ylbut-3-enyl]naphthalen-2-ol |
|---|---|
| PubChem CID | 171287800 |
| Molecular Formula | C19H24N2O |
| Molecular Weight | 296.41 g/mol |
| Exact Mass | 296.19 |
| IUPAC Name | 6-[(1R)-3-methyl-1-piperazin-1-ylbut-3-enyl]naphthalen-2-ol |
| SMILES | C=C(C)C[C@H](c1ccc2cc(O)ccc2c1)N1CCNCC1 |
| InChI | InChI=1S/C19H24N2O/c1-14(2)11-19(21-9-7-20-8-10-21)17-4-3-16-13-18(22)6-5-15(16)12-17/h3-6,12-13,19-20,22H,1,7-11H2,2H3/t19-/m1/s1 |
| InChIKey | ONBUIZQGWUMINW-LJQANCHMSA-N |
| XLogP | 3.46 |
| TPSA | 35.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.41 |
| LogP ≤ 5 | 3.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|