C17H23N3 — CID 171277843
5-[(1S)-3-methyl-1-piperazin-1-ylbut-3-enyl]-1H-indole (PubChem CID 171277843) has the molecular formula C17H23N3 and a molecular weight of 269.39 g/mol. Its IUPAC name is 5-[(1S)-3-methyl-1-piperazin-1-ylbut-3-enyl]-1H-indole.
| Compound Name | 5-[(1S)-3-methyl-1-piperazin-1-ylbut-3-enyl]-1H-indole |
|---|---|
| PubChem CID | 171277843 |
| Molecular Formula | C17H23N3 |
| Molecular Weight | 269.39 g/mol |
| Exact Mass | 269.19 |
| IUPAC Name | 5-[(1S)-3-methyl-1-piperazin-1-ylbut-3-enyl]-1H-indole |
| SMILES | C=C(C)C[C@@H](c1ccc2[nH]ccc2c1)N1CCNCC1 |
| InChI | InChI=1S/C17H23N3/c1-13(2)11-17(20-9-7-18-8-10-20)15-3-4-16-14(12-15)5-6-19-16/h3-6,12,17-19H,1,7-11H2,2H3/t17-/m0/s1 |
| InChIKey | CNZLJASWRKPLGM-KRWDZBQOSA-N |
| XLogP | 3.08 |
| TPSA | 31.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 269.39 |
| LogP ≤ 5 | 3.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|