C16H22Cl2FN3 — CID 171293650
2-fluoro-5-[(1R)-3-methyl-1-piperazin-1-ylbut-3-enyl]benzonitrile;dihydrochloride (PubChem CID 171293650) has the molecular formula C16H22Cl2FN3 and a molecular weight of 346.28 g/mol. Its IUPAC name is 2-fluoro-5-[(1R)-3-methyl-1-piperazin-1-ylbut-3-enyl]benzonitrile;dihydrochloride.
| Compound Name | 2-fluoro-5-[(1R)-3-methyl-1-piperazin-1-ylbut-3-enyl]benzonitrile;dihydrochloride |
|---|---|
| PubChem CID | 171293650 |
| Molecular Formula | C16H22Cl2FN3 |
| Molecular Weight | 346.28 g/mol |
| Exact Mass | 345.12 |
| IUPAC Name | 2-fluoro-5-[(1R)-3-methyl-1-piperazin-1-ylbut-3-enyl]benzonitrile;dihydrochloride |
| SMILES | C=C(C)C[C@H](c1ccc(F)c(C#N)c1)N1CCNCC1.Cl.Cl |
| InChI | InChI=1S/C16H20FN3.2ClH/c1-12(2)9-16(20-7-5-19-6-8-20)13-3-4-15(17)14(10-13)11-18;;/h3-4,10,16,19H,1,5-9H2,2H3;2*1H/t16-;;/m1../s1 |
| InChIKey | RYFISIXPYKXZMR-GGMCWBHBSA-N |
| XLogP | 3.45 |
| TPSA | 39.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.28 |
| LogP ≤ 5 | 3.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|