C14H17Cl2FN4 — CID 171307021
5-[(1R)-2-cyano-1-piperazin-1-ylethyl]-2-fluorobenzonitrile;dihydrochloride (PubChem CID 171307021) has the molecular formula C14H17Cl2FN4 and a molecular weight of 331.22 g/mol. Its IUPAC name is 5-[(1R)-2-cyano-1-piperazin-1-ylethyl]-2-fluorobenzonitrile;dihydrochloride.
| Compound Name | 5-[(1R)-2-cyano-1-piperazin-1-ylethyl]-2-fluorobenzonitrile;dihydrochloride |
|---|---|
| PubChem CID | 171307021 |
| Molecular Formula | C14H17Cl2FN4 |
| Molecular Weight | 331.22 g/mol |
| Exact Mass | 330.08 |
| IUPAC Name | 5-[(1R)-2-cyano-1-piperazin-1-ylethyl]-2-fluorobenzonitrile;dihydrochloride |
| SMILES | Cl.Cl.N#CC[C@H](c1ccc(F)c(C#N)c1)N1CCNCC1 |
| InChI | InChI=1S/C14H15FN4.2ClH/c15-13-2-1-11(9-12(13)10-17)14(3-4-16)19-7-5-18-6-8-19;;/h1-2,9,14,18H,3,5-8H2;2*1H/t14-;;/m1../s1 |
| InChIKey | FREWHKXDUKEMED-FMOMHUKBSA-N |
| XLogP | 2.40 |
| TPSA | 62.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.22 |
| LogP ≤ 5 | 2.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |