C16H28Cl2N2O2 — CID 171273682
1-[(1S)-1-(3,5-dimethoxyphenyl)butyl]piperazine;dihydrochloride (PubChem CID 171273682) has the molecular formula C16H28Cl2N2O2 and a molecular weight of 351.32 g/mol. Its IUPAC name is 1-[(1S)-1-(3,5-dimethoxyphenyl)butyl]piperazine;dihydrochloride.
| Compound Name | 1-[(1S)-1-(3,5-dimethoxyphenyl)butyl]piperazine;dihydrochloride |
|---|---|
| PubChem CID | 171273682 |
| Molecular Formula | C16H28Cl2N2O2 |
| Molecular Weight | 351.32 g/mol |
| Exact Mass | 350.15 |
| IUPAC Name | 1-[(1S)-1-(3,5-dimethoxyphenyl)butyl]piperazine;dihydrochloride |
| SMILES | CCC[C@@H](c1cc(OC)cc(OC)c1)N1CCNCC1.Cl.Cl |
| InChI | InChI=1S/C16H26N2O2.2ClH/c1-4-5-16(18-8-6-17-7-9-18)13-10-14(19-2)12-15(11-13)20-3;;/h10-12,16-17H,4-9H2,1-3H3;2*1H/t16-;;/m0../s1 |
| InChIKey | CYIUGBGWKSIIHM-SQKCAUCHSA-N |
| XLogP | 3.29 |
| TPSA | 33.73 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.32 |
| LogP ≤ 5 | 3.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |