C14H22N2O3 — CID 93471010
(2S)-2-(3,5-dimethoxyphenyl)-2-piperazin-1-ylethanol (PubChem CID 93471010) has the molecular formula C14H22N2O3 and a molecular weight of 266.34 g/mol. Its IUPAC name is (2S)-2-(3,5-dimethoxyphenyl)-2-piperazin-1-ylethanol.
| Compound Name | (2S)-2-(3,5-dimethoxyphenyl)-2-piperazin-1-ylethanol |
|---|---|
| PubChem CID | 93471010 |
| Molecular Formula | C14H22N2O3 |
| Molecular Weight | 266.34 g/mol |
| Exact Mass | 266.16 |
| IUPAC Name | (2S)-2-(3,5-dimethoxyphenyl)-2-piperazin-1-ylethanol |
| SMILES | COc1cc(OC)cc([C@@H](CO)N2CCNCC2)c1 |
| InChI | InChI=1S/C14H22N2O3/c1-18-12-7-11(8-13(9-12)19-2)14(10-17)16-5-3-15-4-6-16/h7-9,14-15,17H,3-6,10H2,1-2H3/t14-/m1/s1 |
| InChIKey | FUEKOECMHLZTFF-CQSZACIVSA-N |
| XLogP | 0.64 |
| TPSA | 53.96 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.34 |
| LogP ≤ 5 | 0.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |