C15H23Cl2N3O — CID 171305873
(3S)-3-(4-ethoxyphenyl)-3-piperazin-1-ylpropanenitrile;dihydrochloride (PubChem CID 171305873) has the molecular formula C15H23Cl2N3O and a molecular weight of 332.28 g/mol. Its IUPAC name is (3S)-3-(4-ethoxyphenyl)-3-piperazin-1-ylpropanenitrile;dihydrochloride.
| Compound Name | (3S)-3-(4-ethoxyphenyl)-3-piperazin-1-ylpropanenitrile;dihydrochloride |
|---|---|
| PubChem CID | 171305873 |
| Molecular Formula | C15H23Cl2N3O |
| Molecular Weight | 332.28 g/mol |
| Exact Mass | 331.12 |
| IUPAC Name | (3S)-3-(4-ethoxyphenyl)-3-piperazin-1-ylpropanenitrile;dihydrochloride |
| SMILES | CCOc1ccc([C@H](CC#N)N2CCNCC2)cc1.Cl.Cl |
| InChI | InChI=1S/C15H21N3O.2ClH/c1-2-19-14-5-3-13(4-6-14)15(7-8-16)18-11-9-17-10-12-18;;/h3-6,15,17H,2,7,9-12H2,1H3;2*1H/t15-;;/m0../s1 |
| InChIKey | CCXFLEZFWJESAI-CKUXDGONSA-N |
| XLogP | 2.79 |
| TPSA | 48.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.28 |
| LogP ≤ 5 | 2.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |