C13H20Cl2N4O — CID 171306740
(3R)-3-(6-methoxy-3-pyridinyl)-3-piperazin-1-ylpropanenitrile;dihydrochloride (PubChem CID 171306740) has the molecular formula C13H20Cl2N4O and a molecular weight of 319.24 g/mol. Its IUPAC name is (3R)-3-(6-methoxy-3-pyridinyl)-3-piperazin-1-ylpropanenitrile;dihydrochloride.
| Compound Name | (3R)-3-(6-methoxy-3-pyridinyl)-3-piperazin-1-ylpropanenitrile;dihydrochloride |
|---|---|
| PubChem CID | 171306740 |
| Molecular Formula | C13H20Cl2N4O |
| Molecular Weight | 319.24 g/mol |
| Exact Mass | 318.10 |
| IUPAC Name | (3R)-3-(6-methoxy-3-pyridinyl)-3-piperazin-1-ylpropanenitrile;dihydrochloride |
| SMILES | COc1ccc([C@@H](CC#N)N2CCNCC2)cn1.Cl.Cl |
| InChI | InChI=1S/C13H18N4O.2ClH/c1-18-13-3-2-11(10-16-13)12(4-5-14)17-8-6-15-7-9-17;;/h2-3,10,12,15H,4,6-9H2,1H3;2*1H/t12-;;/m1../s1 |
| InChIKey | XCXZGEMOTMHQFF-CURYUGHLSA-N |
| XLogP | 1.79 |
| TPSA | 61.18 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.24 |
| LogP ≤ 5 | 1.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |