C16H24Cl2N2O2 — CID 171292898
[4-[(1R)-1-piperazin-1-ylbut-3-enyl]phenyl] acetate;dihydrochloride (PubChem CID 171292898) has the molecular formula C16H24Cl2N2O2 and a molecular weight of 347.29 g/mol. Its IUPAC name is [4-[(1R)-1-piperazin-1-ylbut-3-enyl]phenyl] acetate;dihydrochloride.
| Compound Name | [4-[(1R)-1-piperazin-1-ylbut-3-enyl]phenyl] acetate;dihydrochloride |
|---|---|
| PubChem CID | 171292898 |
| Molecular Formula | C16H24Cl2N2O2 |
| Molecular Weight | 347.29 g/mol |
| Exact Mass | 346.12 |
| IUPAC Name | [4-[(1R)-1-piperazin-1-ylbut-3-enyl]phenyl] acetate;dihydrochloride |
| SMILES | C=CC[C@H](c1ccc(OC(C)=O)cc1)N1CCNCC1.Cl.Cl |
| InChI | InChI=1S/C16H22N2O2.2ClH/c1-3-4-16(18-11-9-17-10-12-18)14-5-7-15(8-6-14)20-13(2)19;;/h3,5-8,16-17H,1,4,9-12H2,2H3;2*1H/t16-;;/m1../s1 |
| InChIKey | ASONMHUYAKCSPG-GGMCWBHBSA-N |
| XLogP | 2.98 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.29 |
| LogP ≤ 5 | 2.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|