C14H21ClN2O3 — CID 171183093
[3-[(1S)-2-hydroxy-1-piperazin-1-ylethyl]phenyl] acetate;hydrochloride (PubChem CID 171183093) has the molecular formula C14H21ClN2O3 and a molecular weight of 300.79 g/mol. Its IUPAC name is [3-[(1S)-2-hydroxy-1-piperazin-1-ylethyl]phenyl] acetate;hydrochloride.
| Compound Name | [3-[(1S)-2-hydroxy-1-piperazin-1-ylethyl]phenyl] acetate;hydrochloride |
|---|---|
| PubChem CID | 171183093 |
| Molecular Formula | C14H21ClN2O3 |
| Molecular Weight | 300.79 g/mol |
| Exact Mass | 300.12 |
| IUPAC Name | [3-[(1S)-2-hydroxy-1-piperazin-1-ylethyl]phenyl] acetate;hydrochloride |
| SMILES | CC(=O)Oc1cccc([C@@H](CO)N2CCNCC2)c1.Cl |
| InChI | InChI=1S/C14H20N2O3.ClH/c1-11(18)19-13-4-2-3-12(9-13)14(10-17)16-7-5-15-6-8-16;/h2-4,9,14-15,17H,5-8,10H2,1H3;1H/t14-;/m1./s1 |
| InChIKey | XQVHSUWDGFAUOQ-PFEQFJNWSA-N |
| XLogP | 0.97 |
| TPSA | 61.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.79 |
| LogP ≤ 5 | 0.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|