C16H26Cl2F2N2O — CID 171307865
1-[(1R)-1-[3-(difluoromethoxy)phenyl]pentyl]piperazine;dihydrochloride (PubChem CID 171307865) has the molecular formula C16H26Cl2F2N2O and a molecular weight of 371.30 g/mol. Its IUPAC name is 1-[(1R)-1-[3-(difluoromethoxy)phenyl]pentyl]piperazine;dihydrochloride.
| Compound Name | 1-[(1R)-1-[3-(difluoromethoxy)phenyl]pentyl]piperazine;dihydrochloride |
|---|---|
| PubChem CID | 171307865 |
| Molecular Formula | C16H26Cl2F2N2O |
| Molecular Weight | 371.30 g/mol |
| Exact Mass | 370.14 |
| IUPAC Name | 1-[(1R)-1-[3-(difluoromethoxy)phenyl]pentyl]piperazine;dihydrochloride |
| SMILES | CCCC[C@H](c1cccc(OC(F)F)c1)N1CCNCC1.Cl.Cl |
| InChI | InChI=1S/C16H24F2N2O.2ClH/c1-2-3-7-15(20-10-8-19-9-11-20)13-5-4-6-14(12-13)21-16(17)18;;/h4-6,12,15-16,19H,2-3,7-11H2,1H3;2*1H/t15-;;/m1../s1 |
| InChIKey | RXDHVGKTTAKEDE-QCUBGVIVSA-N |
| XLogP | 4.27 |
| TPSA | 24.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.30 |
| LogP ≤ 5 | 4.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |