C17H26N2O3 — CID 171273628
1-[(1S)-1-(3,4,5-trimethoxyphenyl)but-3-enyl]piperazine (PubChem CID 171273628) has the molecular formula C17H26N2O3 and a molecular weight of 306.41 g/mol. Its IUPAC name is 1-[(1S)-1-(3,4,5-trimethoxyphenyl)but-3-enyl]piperazine.
| Compound Name | 1-[(1S)-1-(3,4,5-trimethoxyphenyl)but-3-enyl]piperazine |
|---|---|
| PubChem CID | 171273628 |
| Molecular Formula | C17H26N2O3 |
| Molecular Weight | 306.41 g/mol |
| Exact Mass | 306.19 |
| IUPAC Name | 1-[(1S)-1-(3,4,5-trimethoxyphenyl)but-3-enyl]piperazine |
| SMILES | C=CC[C@@H](c1cc(OC)c(OC)c(OC)c1)N1CCNCC1 |
| InChI | InChI=1S/C17H26N2O3/c1-5-6-14(19-9-7-18-8-10-19)13-11-15(20-2)17(22-4)16(12-13)21-3/h5,11-12,14,18H,1,6-10H2,2-4H3/t14-/m0/s1 |
| InChIKey | GKOPXCJXWVBDBS-AWEZNQCLSA-N |
| XLogP | 2.23 |
| TPSA | 42.96 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.41 |
| LogP ≤ 5 | 2.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|