C13H18Br2N2O2 — CID 171296289
2,3-dibromo-6-methoxy-4-[(1R)-1-piperazin-1-ylethyl]phenol (PubChem CID 171296289) has the molecular formula C13H18Br2N2O2 and a molecular weight of 394.11 g/mol. Its IUPAC name is 2,3-dibromo-6-methoxy-4-[(1R)-1-piperazin-1-ylethyl]phenol.
| Compound Name | 2,3-dibromo-6-methoxy-4-[(1R)-1-piperazin-1-ylethyl]phenol |
|---|---|
| PubChem CID | 171296289 |
| Molecular Formula | C13H18Br2N2O2 |
| Molecular Weight | 394.11 g/mol |
| Exact Mass | 391.97 |
| IUPAC Name | 2,3-dibromo-6-methoxy-4-[(1R)-1-piperazin-1-ylethyl]phenol |
| SMILES | COc1cc([C@@H](C)N2CCNCC2)c(Br)c(Br)c1O |
| InChI | InChI=1S/C13H18Br2N2O2/c1-8(17-5-3-16-4-6-17)9-7-10(19-2)13(18)12(15)11(9)14/h7-8,16,18H,3-6H2,1-2H3/t8-/m1/s1 |
| InChIKey | RJDCRSJZBPLBBP-MRVPVSSYSA-N |
| XLogP | 2.89 |
| TPSA | 44.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.11 |
| LogP ≤ 5 | 2.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |