C18H26Br2N2O2 — CID 171283687
2,3-dibromo-4-[(S)-cyclohexyl(piperazin-1-yl)methyl]-6-methoxyphenol (PubChem CID 171283687) has the molecular formula C18H26Br2N2O2 and a molecular weight of 462.23 g/mol. Its IUPAC name is 2,3-dibromo-4-[(S)-cyclohexyl(piperazin-1-yl)methyl]-6-methoxyphenol.
| Compound Name | 2,3-dibromo-4-[(S)-cyclohexyl(piperazin-1-yl)methyl]-6-methoxyphenol |
|---|---|
| PubChem CID | 171283687 |
| Molecular Formula | C18H26Br2N2O2 |
| Molecular Weight | 462.23 g/mol |
| Exact Mass | 460.04 |
| IUPAC Name | 2,3-dibromo-4-[(S)-cyclohexyl(piperazin-1-yl)methyl]-6-methoxyphenol |
| SMILES | COc1cc([C@H](C2CCCCC2)N2CCNCC2)c(Br)c(Br)c1O |
| InChI | InChI=1S/C18H26Br2N2O2/c1-24-14-11-13(15(19)16(20)18(14)23)17(12-5-3-2-4-6-12)22-9-7-21-8-10-22/h11-12,17,21,23H,2-10H2,1H3/t17-/m0/s1 |
| InChIKey | ZOCUOTDVZHSLSF-KRWDZBQOSA-N |
| XLogP | 4.45 |
| TPSA | 44.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.23 |
| LogP ≤ 5 | 4.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |