C15H23BrCl2N2O2 — CID 171288214
1-[(1R)-1-(4-bromo-3,5-dimethoxyphenyl)prop-2-enyl]piperazine;dihydrochloride (PubChem CID 171288214) has the molecular formula C15H23BrCl2N2O2 and a molecular weight of 414.17 g/mol. Its IUPAC name is 1-[(1R)-1-(4-bromo-3,5-dimethoxyphenyl)prop-2-enyl]piperazine;dihydrochloride.
| Compound Name | 1-[(1R)-1-(4-bromo-3,5-dimethoxyphenyl)prop-2-enyl]piperazine;dihydrochloride |
|---|---|
| PubChem CID | 171288214 |
| Molecular Formula | C15H23BrCl2N2O2 |
| Molecular Weight | 414.17 g/mol |
| Exact Mass | 412.03 |
| IUPAC Name | 1-[(1R)-1-(4-bromo-3,5-dimethoxyphenyl)prop-2-enyl]piperazine;dihydrochloride |
| SMILES | C=C[C@H](c1cc(OC)c(Br)c(OC)c1)N1CCNCC1.Cl.Cl |
| InChI | InChI=1S/C15H21BrN2O2.2ClH/c1-4-12(18-7-5-17-6-8-18)11-9-13(19-2)15(16)14(10-11)20-3;;/h4,9-10,12,17H,1,5-8H2,2-3H3;2*1H/t12-;;/m1../s1 |
| InChIKey | PUPIJNLUVFFBDQ-CURYUGHLSA-N |
| XLogP | 3.44 |
| TPSA | 33.73 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.17 |
| LogP ≤ 5 | 3.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|