C15H12BrF4N — CID 102758784
(2-bromo-3-fluorophenyl)-[2-methyl-4-(trifluoromethyl)phenyl]methanamine (PubChem CID 102758784) has the molecular formula C15H12BrF4N and a molecular weight of 362.16 g/mol. Its IUPAC name is (2-bromo-3-fluorophenyl)-[2-methyl-4-(trifluoromethyl)phenyl]methanamine.
| Compound Name | (2-bromo-3-fluorophenyl)-[2-methyl-4-(trifluoromethyl)phenyl]methanamine |
|---|---|
| PubChem CID | 102758784 |
| Molecular Formula | C15H12BrF4N |
| Molecular Weight | 362.16 g/mol |
| Exact Mass | 361.01 |
| IUPAC Name | (2-bromo-3-fluorophenyl)-[2-methyl-4-(trifluoromethyl)phenyl]methanamine |
| SMILES | Cc1cc(C(F)(F)F)ccc1C(N)c1cccc(F)c1Br |
| InChI | InChI=1S/C15H12BrF4N/c1-8-7-9(15(18,19)20)5-6-10(8)14(21)11-3-2-4-12(17)13(11)16/h2-7,14H,21H2,1H3 |
| InChIKey | KGUSNLDLEWBSSD-UHFFFAOYSA-N |
| XLogP | 4.96 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.16 |
| LogP ≤ 5 | 4.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |