C11H11F5N2 — CID 105319560
[3-methyl-1-(2,3,4,5,6-pentafluorophenyl)but-3-enyl]hydrazine (PubChem CID 105319560) has the molecular formula C11H11F5N2 and a molecular weight of 266.21 g/mol. Its IUPAC name is [3-methyl-1-(2,3,4,5,6-pentafluorophenyl)but-3-enyl]hydrazine.
| Compound Name | [3-methyl-1-(2,3,4,5,6-pentafluorophenyl)but-3-enyl]hydrazine |
|---|---|
| PubChem CID | 105319560 |
| Molecular Formula | C11H11F5N2 |
| Molecular Weight | 266.21 g/mol |
| Exact Mass | 266.08 |
| IUPAC Name | [3-methyl-1-(2,3,4,5,6-pentafluorophenyl)but-3-enyl]hydrazine |
| SMILES | C=C(C)CC(NN)c1c(F)c(F)c(F)c(F)c1F |
| InChI | InChI=1S/C11H11F5N2/c1-4(2)3-5(18-17)6-7(12)9(14)11(16)10(15)8(6)13/h5,18H,1,3,17H2,2H3 |
| InChIKey | FXOUSAPLUNSHLD-UHFFFAOYSA-N |
| XLogP | 2.85 |
| TPSA | 38.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.21 |
| LogP ≤ 5 | 2.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|