C10H14INO — CID 77130523
2-amino-2-(4-iodo-3,5-dimethylphenyl)ethanol (PubChem CID 77130523) has the molecular formula C10H14INO and a molecular weight of 291.13 g/mol. Its IUPAC name is 2-amino-2-(4-iodo-3,5-dimethylphenyl)ethanol.
| Compound Name | 2-amino-2-(4-iodo-3,5-dimethylphenyl)ethanol |
|---|---|
| PubChem CID | 77130523 |
| Molecular Formula | C10H14INO |
| Molecular Weight | 291.13 g/mol |
| Exact Mass | 291.01 |
| IUPAC Name | 2-amino-2-(4-iodo-3,5-dimethylphenyl)ethanol |
| SMILES | Cc1cc(C(N)CO)cc(C)c1I |
| InChI | InChI=1S/C10H14INO/c1-6-3-8(9(12)5-13)4-7(2)10(6)11/h3-4,9,13H,5,12H2,1-2H3 |
| InChIKey | HQHMMOBEUCAZRW-UHFFFAOYSA-N |
| XLogP | 1.90 |
| TPSA | 46.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.13 |
| LogP ≤ 5 | 1.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|