C11H14N2O — CID 130668278
4-[(1R)-1-amino-2-hydroxyethyl]-2,6-dimethylbenzonitrile (PubChem CID 130668278) has the molecular formula C11H14N2O and a molecular weight of 190.25 g/mol. Its IUPAC name is 4-[(1R)-1-amino-2-hydroxyethyl]-2,6-dimethylbenzonitrile.
| Compound Name | 4-[(1R)-1-amino-2-hydroxyethyl]-2,6-dimethylbenzonitrile |
|---|---|
| PubChem CID | 130668278 |
| Molecular Formula | C11H14N2O |
| Molecular Weight | 190.25 g/mol |
| Exact Mass | 190.11 |
| IUPAC Name | 4-[(1R)-1-amino-2-hydroxyethyl]-2,6-dimethylbenzonitrile |
| SMILES | Cc1cc([C@@H](N)CO)cc(C)c1C#N |
| InChI | InChI=1S/C11H14N2O/c1-7-3-9(11(13)6-14)4-8(2)10(7)5-12/h3-4,11,14H,6,13H2,1-2H3/t11-/m0/s1 |
| InChIKey | DFYCELAPKGZJJU-NSHDSACASA-N |
| XLogP | 1.17 |
| TPSA | 70.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 190.25 |
| LogP ≤ 5 | 1.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |