C11H13Cl2N — CID 130817353
(1S)-1-(3,5-dichlorophenyl)-3-methylbut-3-en-1-amine (PubChem CID 130817353) has the molecular formula C11H13Cl2N and a molecular weight of 230.14 g/mol. Its IUPAC name is (1S)-1-(3,5-dichlorophenyl)-3-methylbut-3-en-1-amine.
| Compound Name | (1S)-1-(3,5-dichlorophenyl)-3-methylbut-3-en-1-amine |
|---|---|
| PubChem CID | 130817353 |
| Molecular Formula | C11H13Cl2N |
| Molecular Weight | 230.14 g/mol |
| Exact Mass | 229.04 |
| IUPAC Name | (1S)-1-(3,5-dichlorophenyl)-3-methylbut-3-en-1-amine |
| SMILES | C=C(C)C[C@H](N)c1cc(Cl)cc(Cl)c1 |
| InChI | InChI=1S/C11H13Cl2N/c1-7(2)3-11(14)8-4-9(12)6-10(13)5-8/h4-6,11H,1,3,14H2,2H3/t11-/m0/s1 |
| InChIKey | RTJUHTDUXAOJCR-NSHDSACASA-N |
| XLogP | 3.96 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 230.14 |
| LogP ≤ 5 | 3.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|