C11H12Cl2O — CID 115816915
1-(3,5-dichlorophenyl)-3-methylbut-3-en-1-ol (PubChem CID 115816915) has the molecular formula C11H12Cl2O and a molecular weight of 231.12 g/mol. Its IUPAC name is 1-(3,5-dichlorophenyl)-3-methylbut-3-en-1-ol.
| Compound Name | 1-(3,5-dichlorophenyl)-3-methylbut-3-en-1-ol |
|---|---|
| PubChem CID | 115816915 |
| Molecular Formula | C11H12Cl2O |
| Molecular Weight | 231.12 g/mol |
| Exact Mass | 230.03 |
| IUPAC Name | 1-(3,5-dichlorophenyl)-3-methylbut-3-en-1-ol |
| SMILES | C=C(C)CC(O)c1cc(Cl)cc(Cl)c1 |
| InChI | InChI=1S/C11H12Cl2O/c1-7(2)3-11(14)8-4-9(12)6-10(13)5-8/h4-6,11,14H,1,3H2,2H3 |
| InChIKey | HWAZEBOCRUDDFM-UHFFFAOYSA-N |
| XLogP | 3.99 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 231.12 |
| LogP ≤ 5 | 3.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|