C12H15FO2 — CID 115816783
1-(4-fluoro-3-methoxyphenyl)-3-methylbut-3-en-1-ol (PubChem CID 115816783) has the molecular formula C12H15FO2 and a molecular weight of 210.25 g/mol. Its IUPAC name is 1-(4-fluoro-3-methoxyphenyl)-3-methylbut-3-en-1-ol.
| Compound Name | 1-(4-fluoro-3-methoxyphenyl)-3-methylbut-3-en-1-ol |
|---|---|
| PubChem CID | 115816783 |
| Molecular Formula | C12H15FO2 |
| Molecular Weight | 210.25 g/mol |
| Exact Mass | 210.11 |
| IUPAC Name | 1-(4-fluoro-3-methoxyphenyl)-3-methylbut-3-en-1-ol |
| SMILES | C=C(C)CC(O)c1ccc(F)c(OC)c1 |
| InChI | InChI=1S/C12H15FO2/c1-8(2)6-11(14)9-4-5-10(13)12(7-9)15-3/h4-5,7,11,14H,1,6H2,2-3H3 |
| InChIKey | IGCLGOBZLIWXNB-UHFFFAOYSA-N |
| XLogP | 2.83 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 210.25 |
| LogP ≤ 5 | 2.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|