C9H7Cl2NO — CID 79118978
3-(3,5-dichlorophenyl)-3-hydroxypropanenitrile (PubChem CID 79118978) has the molecular formula C9H7Cl2NO and a molecular weight of 216.07 g/mol. Its IUPAC name is 3-(3,5-dichlorophenyl)-3-hydroxypropanenitrile.
| Compound Name | 3-(3,5-dichlorophenyl)-3-hydroxypropanenitrile |
|---|---|
| PubChem CID | 79118978 |
| Molecular Formula | C9H7Cl2NO |
| Molecular Weight | 216.07 g/mol |
| Exact Mass | 214.99 |
| IUPAC Name | 3-(3,5-dichlorophenyl)-3-hydroxypropanenitrile |
| SMILES | N#CCC(O)c1cc(Cl)cc(Cl)c1 |
| InChI | InChI=1S/C9H7Cl2NO/c10-7-3-6(4-8(11)5-7)9(13)1-2-12/h3-5,9,13H,1H2 |
| InChIKey | RMHYPRDPACWNNQ-UHFFFAOYSA-N |
| XLogP | 2.94 |
| TPSA | 44.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 216.07 |
| LogP ≤ 5 | 2.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |