C14H16F6O2 — CID 174317253
3-[3,5-bis(trifluoromethyl)phenyl]-4-methoxypentan-2-ol (PubChem CID 174317253) has the molecular formula C14H16F6O2 and a molecular weight of 330.27 g/mol. Its IUPAC name is 3-[3,5-bis(trifluoromethyl)phenyl]-4-methoxypentan-2-ol.
| Compound Name | 3-[3,5-bis(trifluoromethyl)phenyl]-4-methoxypentan-2-ol |
|---|---|
| PubChem CID | 174317253 |
| Molecular Formula | C14H16F6O2 |
| Molecular Weight | 330.27 g/mol |
| Exact Mass | 330.11 |
| IUPAC Name | 3-[3,5-bis(trifluoromethyl)phenyl]-4-methoxypentan-2-ol |
| SMILES | COC(C)C(c1cc(C(F)(F)F)cc(C(F)(F)F)c1)C(C)O |
| InChI | InChI=1S/C14H16F6O2/c1-7(21)12(8(2)22-3)9-4-10(13(15,16)17)6-11(5-9)14(18,19)20/h4-8,12,21H,1-3H3 |
| InChIKey | FUBBTOUQPHHOAJ-UHFFFAOYSA-N |
| XLogP | 4.22 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.27 |
| LogP ≤ 5 | 4.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |