About 4-[1-[4-(diethylamino)-2-ethylphenyl]-2-phenylethyl]-N,N,3-triethylaniline
4-[1-[4-(diethylamino)-2-ethylphenyl]-2-phenylethyl]-N,N,3-triethylaniline (PubChem CID 54528925) has the molecular formula C32H44N2
and a molecular weight of 456.72 g/mol. Its IUPAC name is 4-[1-[4-(diethylamino)-2-ethylphenyl]-2-phenylethyl]-N,N,3-triethylaniline.
Molecular Properties
| Compound Name | 4-[1-[4-(diethylamino)-2-ethylphenyl]-2-phenylethyl]-N,N,3-triethylaniline |
| PubChem CID | 54528925 |
| Molecular Formula | C32H44N2 |
| Molecular Weight | 456.72 g/mol |
| Exact Mass | 456.35 |
| IUPAC Name | 4-[1-[4-(diethylamino)-2-ethylphenyl]-2-phenylethyl]-N,N,3-triethylaniline |
| SMILES | CCc1cc(N(CC)CC)ccc1C(Cc1ccccc1)c1ccc(N(CC)CC)cc1CC |
| InChI | InChI=1S/C32H44N2/c1-7-26-23-28(33(9-3)10-4)18-20-30(26)32(22-25-16-14-13-15-17-25)31-21-19-29(24-27(31)8-2)34(11-5)12-6/h13-21,23-24,32H,7-12,22H2,1-6H3 |
| InChIKey | YVCAVZIDYIOWEA-UHFFFAOYSA-N |
| XLogP | 7.88 |
| TPSA | 6.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 34 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 456.72 |
| LogP ≤ 5 | 7.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'}, {'alert_name': 'anil_di_alk_F(14)', 'substructure': 'N/A'} |
|---|
Analyze 4-[1-[4-(diethylamino)-2-ethylphenyl]-2-phenylethyl]-N,N,3-triethylaniline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-[1-[4-(diethylamino)-2-ethylphenyl]-2-phenylethyl]-N,N,3-triethylaniline?
The IUPAC name of 4-[1-[4-(diethylamino)-2-ethylphenyl]-2-phenylethyl]-N,N,3-triethylaniline (CID 54528925) is 4-[1-[4-(diethylamino)-2-ethylphenyl]-2-phenylethyl]-N,N,3-triethylaniline.
What is the SMILES notation for 4-[1-[4-(diethylamino)-2-ethylphenyl]-2-phenylethyl]-N,N,3-triethylaniline?
The canonical SMILES for 4-[1-[4-(diethylamino)-2-ethylphenyl]-2-phenylethyl]-N,N,3-triethylaniline is CCc1cc(N(CC)CC)ccc1C(Cc1ccccc1)c1ccc(N(CC)CC)cc1CC.
What is the InChIKey of 4-[1-[4-(diethylamino)-2-ethylphenyl]-2-phenylethyl]-N,N,3-triethylaniline?
The InChIKey is YVCAVZIDYIOWEA-UHFFFAOYSA-N. The full InChI is InChI=1S/C32H44N2/c1-7-26-23-28(33(9-3)10-4)18-20-30(26)32(22-25-16-14-13-15-17-25)31-21-19-29(24-27(31)8-2)34(11-5)12-6/h13-21,23-24,32H,7-12,22H2,1-6H3.
What are the key properties of 4-[1-[4-(diethylamino)-2-ethylphenyl]-2-phenylethyl]-N,N,3-triethylaniline?
4-[1-[4-(diethylamino)-2-ethylphenyl]-2-phenylethyl]-N,N,3-triethylaniline has a molecular weight of 456.72 g/mol, XLogP of 7.88, 12 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[1-[4-(diethylamino)-2-ethylphenyl]-2-phenylethyl]-N,N,3-triethylaniline is sourced from PubChem (CID 54528925), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).