C17H22N2 — CID 171314485
(R)-(4-methylnaphthalen-1-yl)-piperidin-4-ylmethanamine (PubChem CID 171314485) has the molecular formula C17H22N2 and a molecular weight of 254.38 g/mol. Its IUPAC name is (R)-(4-methylnaphthalen-1-yl)-piperidin-4-ylmethanamine.
| Compound Name | (R)-(4-methylnaphthalen-1-yl)-piperidin-4-ylmethanamine |
|---|---|
| PubChem CID | 171314485 |
| Molecular Formula | C17H22N2 |
| Molecular Weight | 254.38 g/mol |
| Exact Mass | 254.18 |
| IUPAC Name | (R)-(4-methylnaphthalen-1-yl)-piperidin-4-ylmethanamine |
| SMILES | Cc1ccc([C@H](N)C2CCNCC2)c2ccccc12 |
| InChI | InChI=1S/C17H22N2/c1-12-6-7-16(15-5-3-2-4-14(12)15)17(18)13-8-10-19-11-9-13/h2-7,13,17,19H,8-11,18H2,1H3/t17-/m1/s1 |
| InChIKey | QISUBFGVEILBMW-QGZVFWFLSA-N |
| XLogP | 3.15 |
| TPSA | 38.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 254.38 |
| LogP ≤ 5 | 3.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |